Index of /ur/horiz/sotiyat/mufti_taqi_usmani
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | (01)RM-Ramadaan_Saba..> | 2019-08-31 16:26 | 6.1M | |
![[SND]](/icons/sound2.gif) | (P_1)Tafseer Surah A..> | 2019-08-31 16:26 | 12M | |
![[SND]](/icons/sound2.gif) | (P_2)Tafseer Surah A..> | 2019-08-31 16:26 | 14M | |
![[SND]](/icons/sound2.gif) | -Khatme-Bukhari-Wals..> | 2019-08-31 16:26 | 14M | |
![[SND]](/icons/sound2.gif) | 01_Qadr_e_Neyamat_ba..> | 2019-08-31 16:26 | 7.9M | |
![[SND]](/icons/sound2.gif) | 02_Auqat_e_Zindagi_k..> | 2019-08-31 16:26 | 9.5M | |
![[SND]](/icons/sound2.gif) | 03_Aadab_e_Maashrat ..> | 2019-08-31 16:26 | 13M | |
![[SND]](/icons/sound2.gif) | 04_Deen Shariyat ka ..> | 2019-08-31 16:26 | 11M | |
![[SND]](/icons/sound2.gif) | 05 Zikr-ul-Allah ka ..> | 2024-10-03 05:20 | 13M | |
![[SND]](/icons/sound2.gif) | 06_Ibarat O Dras E K..> | 2019-08-31 16:26 | 6.2M | |
![[SND]](/icons/sound2.gif) | 1- Aghaz Taleemi Saa..> | 2024-05-15 06:34 | 9.5M | |
![[SND]](/icons/sound2.gif) | 2- Ramadan Sabar aur..> | 2025-03-15 03:56 | 6.9M | |
![[SND]](/icons/sound2.gif) | 3- By Chain Logo Ki ..> | 2024-01-28 04:20 | 14M | |
![[SND]](/icons/sound2.gif) | 3- Kitab Shariat O T..> | 2024-03-09 07:01 | 14M | |
![[SND]](/icons/sound2.gif) | 3- Rusi Musalmano Ki..> | 2025-05-29 05:31 | 6.3M | |
![[SND]](/icons/sound2.gif) | 4- Apny Or Dosro Ky ..> | 2024-02-03 06:56 | 14M | |
![[SND]](/icons/sound2.gif) | 4- Kitab Shariat O T..> | 2024-03-09 07:07 | 12M | |
![[SND]](/icons/sound2.gif) | 4_ommooor_e_baaar_e_..> | 2019-08-31 16:27 | 14M | |
![[SND]](/icons/sound2.gif) | 5- Allah O Rasool Or..> | 2024-02-20 03:44 | 14M | |
![[SND]](/icons/sound2.gif) | 5- Sa'adat e Daren D..> | 2024-05-15 06:09 | 12M | |
![[ ]](/icons/unknown.gif) | 6- Shab e Bara'at Al..> | 2024-02-26 04:50 | 13M | |
![[SND]](/icons/sound2.gif) | 7- Insan Ki Zindagi ..> | 2024-03-03 03:51 | 14M | |
![[SND]](/icons/sound2.gif) | 8- Insan Ki Zindagi ..> | 2024-03-09 07:16 | 14M | |
![[SND]](/icons/sound2.gif) | 9- Ramazan Ul Mubara..> | 2024-03-19 04:38 | 14M | |
![[SND]](/icons/sound2.gif) | 10- Badar O Fath e M..> | 2024-03-23 05:04 | 13M | |
![[SND]](/icons/sound2.gif) | 11- Mujhy Zindagi My..> | 2023-09-02 08:31 | 7.8M | |
![[SND]](/icons/sound2.gif) | 11- Zakat ki Farziya..> | 2024-03-31 05:41 | 12M | |
![[SND]](/icons/sound2.gif) | 12- Ramadan ke Akhri..> | 2024-04-14 05:34 | 13M | |
![[SND]](/icons/sound2.gif) | 13- Ramadan ka baad ..> | 2024-04-21 03:19 | 9.7M | |
![[SND]](/icons/sound2.gif) | 14-August-2018 Taqre..> | 2019-08-31 16:26 | 8.3M | |
![[SND]](/icons/sound2.gif) | 14- Hajj ki Farziat ..> | 2024-04-21 03:21 | 12M | |
![[SND]](/icons/sound2.gif) | 14 August yum e Azad..> | 2019-08-31 16:26 | 7.3M | |
![[SND]](/icons/sound2.gif) | 15- Akhirat ki Tayar..> | 2024-05-15 04:56 | 11M | |
![[SND]](/icons/sound2.gif) | 16- Masla Falastin_ ..> | 2024-05-19 07:40 | 12M | |
![[SND]](/icons/sound2.gif) | 17- Pakistan My Quda..> | 2024-05-27 05:21 | 13M | |
![[SND]](/icons/sound2.gif) | 18--Ulama_par_sufaha..> | 2019-08-31 16:26 | 2.3M | |
![[SND]](/icons/sound2.gif) | 18- Naya Islami Saal..> | 2024-07-09 05:01 | 13M | |
![[SND]](/icons/sound2.gif) | 19- Youm e A'ashura ..> | 2024-07-13 08:16 | 12M | |
![[SND]](/icons/sound2.gif) | 20- Ismaeel Haniah _..> | 2024-08-05 03:47 | 12M | |
![[SND]](/icons/sound2.gif) | 21 - Ramadan -1446 _..> | 2025-03-23 04:33 | 5.3M | |
![[SND]](/icons/sound2.gif) | 21- Zikr-ul-Allah ki..> | 2024-10-13 06:44 | 12M | |
![[SND]](/icons/sound2.gif) | 21 Ramadan Majlis-e-..> | 2024-04-14 04:32 | 5.6M | |
![[SND]](/icons/sound2.gif) | 22 - Ramadan -1446 _..> | 2025-03-24 04:00 | 4.1M | |
![[SND]](/icons/sound2.gif) | 22- Zikr-ul-Allah Ka..> | 2024-10-17 03:44 | 13M | |
![[SND]](/icons/sound2.gif) | 22 Ramadan Majlis-e-..> | 2024-04-14 04:37 | 5.3M | |
![[SND]](/icons/sound2.gif) | 23 - Ramadan -1446 _..> | 2025-03-25 03:41 | 4.2M | |
![[SND]](/icons/sound2.gif) | 23- Zikr-ul-Allah ha..> | 2024-11-04 03:32 | 11M | |
![[SND]](/icons/sound2.gif) | 23 Ramadan Majlis-e-..> | 2024-04-14 04:40 | 5.9M | |
![[SND]](/icons/sound2.gif) | 24- Aankh ki Naimat ..> | 2024-12-29 04:47 | 12M | |
![[SND]](/icons/sound2.gif) | 24 - Ramadan -1446 _..> | 2025-03-26 03:53 | 6.4M | |
![[SND]](/icons/sound2.gif) | 24 Ramadan Majlis-e-..> | 2024-04-14 04:44 | 6.8M | |
![[SND]](/icons/sound2.gif) | 27 Ramadan Majlis-e-..> | 2024-04-14 04:47 | 7.7M | |
![[SND]](/icons/sound2.gif) | 28 - Ramadan -1446 _..> | 2025-03-30 02:17 | 4.0M | |
![[SND]](/icons/sound2.gif) | 28 Ramadan Majlis-e-..> | 2024-04-14 05:10 | 12M | |
![[SND]](/icons/sound2.gif) | 29 Ramadan Majlis-e-..> | 2024-04-14 05:15 | 10M | |
![[SND]](/icons/sound2.gif) | 42--Ramadan_ki_tayye..> | 2019-08-31 16:27 | 2.3M | |
![[SND]](/icons/sound2.gif) | 167_TAUBAH_TIRYAQ_E_..> | 2019-08-31 16:26 | 3.0M | |
![[SND]](/icons/sound2.gif) | 173_Sehat_w_faragat-..> | 2019-08-31 16:26 | 6.7M | |
![[SND]](/icons/sound2.gif) | 195_Namaz_Main_Khush..> | 2019-08-31 16:26 | 2.3M | |
![[SND]](/icons/sound2.gif) | 197_AMAR_BIL_MAAROOF..> | 2019-08-31 16:26 | 2.8M | |
![[SND]](/icons/sound2.gif) | 199_Aay_Insaan_Aadat..> | 2019-08-31 16:26 | 3.1M | |
![[SND]](/icons/sound2.gif) | 203_Ramadan_ki_qadar..> | 2019-08-31 16:26 | 6.8M | |
![[ ]](/icons/unknown.gif) | 204_Duaa_ka_ehtemam_..> | 2019-08-31 16:26 | 2.0M | |
![[ ]](/icons/unknown.gif) | 205_Duaa_Raghbat_sai..> | 2019-08-31 16:26 | 2.5M | |
![[ ]](/icons/unknown.gif) | 206_Duaa_mai_ezhar e..> | 2019-08-31 16:26 | 1.0M | |
![[SND]](/icons/sound2.gif) | 207_Ehtyaj e ELAHI_M..> | 2019-08-31 16:26 | 1.7M | |
![[SND]](/icons/sound2.gif) | 208_Duaa_ki_qabuliat..> | 2019-08-31 16:26 | 1.3M | |
![[SND]](/icons/sound2.gif) | 209_Duaa_muassar_tad..> | 2019-08-31 16:26 | 4.7M | |
![[SND]](/icons/sound2.gif) | 211_Ebaadat_ki_takme..> | 2019-08-31 16:26 | 1.0M | |
![[SND]](/icons/sound2.gif) | 212_Ramdan_aur_sabar..> | 2019-08-31 16:26 | 2.1M | |
![[SND]](/icons/sound2.gif) | 213_waqt_ka_Takaza 0..> | 2019-08-31 16:26 | 1.9M | |
![[SND]](/icons/sound2.gif) | 214_Maasiat_sai_nifa..> | 2019-08-31 16:26 | 2.4M | |
![[SND]](/icons/sound2.gif) | 215_Ghafalat_sai_bed..> | 2019-08-31 16:26 | 2.0M | |
![[SND]](/icons/sound2.gif) | 216_Gham_w_taareeki_..> | 2019-08-31 16:26 | 2.0M | |
![[SND]](/icons/sound2.gif) | 217_Insan_ki_Takhlee..> | 2019-08-31 16:26 | 2.5M | |
![[SND]](/icons/sound2.gif) | 218_Taqwa_ki_kushish..> | 2019-08-31 16:26 | 2.5M | |
![[SND]](/icons/sound2.gif) | 219_Omar e_taveel_ k..> | 2019-08-31 16:26 | 2.6M | |
![[SND]](/icons/sound2.gif) | 220_Mufti M Taqi Usm..> | 2019-08-31 16:26 | 2.5M | |
![[SND]](/icons/sound2.gif) | 221_Mufti M Taqi Usm..> | 2019-08-31 16:26 | 2.5M | |
![[SND]](/icons/sound2.gif) | 222_Maut_Momen_ke_ly..> | 2019-08-31 16:26 | 2.5M | |
![[SND]](/icons/sound2.gif) | 223_ Haququl_ibaad_k..> | 2019-08-31 16:26 | 2.4M | |
![[SND]](/icons/sound2.gif) | 224_Rajow_elallah 2..> | 2019-08-31 16:26 | 2.5M | |
![[SND]](/icons/sound2.gif) | 225_Haram_w_Mushtaba..> | 2019-08-31 16:26 | 8.9M | |
![[SND]](/icons/sound2.gif) | 226_ Mujahida e Nafs..> | 2019-08-31 16:26 | 2.7M | |
![[SND]](/icons/sound2.gif) | 227_Duty_ki_Aadayegi..> | 2019-08-31 16:26 | 2.9M | |
![[SND]](/icons/sound2.gif) | 228_Shaaban_Ramadan_..> | 2019-08-31 16:26 | 2.8M | |
![[SND]](/icons/sound2.gif) | 230_Zikr_e_Lisani_bh..> | 2019-08-31 16:26 | 1.0M | |
![[SND]](/icons/sound2.gif) | 231_Zikir_Momin_ka_h..> | 2019-08-31 16:26 | 1.1M | |
![[SND]](/icons/sound2.gif) | 232_Zikr_O_Fikr_Aqal..> | 2019-08-31 16:26 | 1.5M | |
![[SND]](/icons/sound2.gif) | 233_Zikr_0_Fikr_Aqal..> | 2019-08-31 16:26 | 1.4M | |
![[SND]](/icons/sound2.gif) | 234_Zikr_O_Ebadaat_m..> | 2019-08-31 16:26 | 1.0M | |
![[SND]](/icons/sound2.gif) | 235_Zikr_ka_maqsad_t..> | 2019-08-31 16:26 | 1.4M | |
![[SND]](/icons/sound2.gif) | 236_Emaan_ke_shoabay..> | 2019-08-31 16:26 | 1.7M | |
![[SND]](/icons/sound2.gif) | 237_Neyyat_ka_daroma..> | 2019-08-31 16:26 | 2.3M | |
![[SND]](/icons/sound2.gif) | 239_Ebaadat_mai_neyy..> | 2019-08-31 16:26 | 7.6M | |
![[SND]](/icons/sound2.gif) | 240_Aamal_par_neyyat..> | 2019-08-31 16:26 | 6.4M | |
![[SND]](/icons/sound2.gif) | 241_Hadees-s-Jibraee..> | 2019-08-31 16:26 | 6.4M | |
![[SND]](/icons/sound2.gif) | 242_Adna Neki ko Kam..> | 2019-08-31 16:26 | 6.2M | |
![[SND]](/icons/sound2.gif) | 243_Hadith_e_Jibrael..> | 2019-08-31 16:26 | 3.6M | |
![[SND]](/icons/sound2.gif) | 246_Hadith_e_Jibrael..> | 2019-08-31 16:26 | 5.6M | |
![[SND]](/icons/sound2.gif) | 247_Hadith_e_Jibrael..> | 2019-08-31 16:26 | 5.2M | |
![[SND]](/icons/sound2.gif) | 248_Hadith_e_Jibrael..> | 2019-08-31 16:26 | 8.6M | |
![[SND]](/icons/sound2.gif) | 249_Hadith_e_Jibrael..> | 2019-08-31 16:26 | 9.0M | |
![[SND]](/icons/sound2.gif) | 250_Hadith_e_Jibrael..> | 2019-08-31 16:26 | 6.9M | |
![[SND]](/icons/sound2.gif) | 251_Hadith_e_Jibrael..> | 2019-08-31 16:26 | 5.5M | |
![[SND]](/icons/sound2.gif) | 252_Hadith_e_Jibrael..> | 2019-08-31 16:26 | 5.7M | |
![[SND]](/icons/sound2.gif) | 253_Hadith_e_Jibrael..> | 2019-08-31 16:26 | 6.8M | |
![[SND]](/icons/sound2.gif) | 254_Pur_Fitan_daur_m..> | 2019-08-31 16:26 | 5.6M | |
![[SND]](/icons/sound2.gif) | 255_Maujudah_halat_m..> | 2019-08-31 16:26 | 5.7M | |
![[SND]](/icons/sound2.gif) | 256_Madaris_e_Deeniy..> | 2019-08-31 16:26 | 4.9M | |
![[SND]](/icons/sound2.gif) | 258_Ramadan_ke_maamu..> | 2019-08-31 16:26 | 4.8M | |
![[SND]](/icons/sound2.gif) | 259_Ramadan_Shahar_e..> | 2019-08-31 16:26 | 4.8M | |
![[SND]](/icons/sound2.gif) | 260_Tafseer_Suratul_..> | 2019-08-31 16:26 | 5.4M | |
![[SND]](/icons/sound2.gif) | 261_Tafseer_Suratul_..> | 2019-08-31 16:26 | 4.2M | |
![[SND]](/icons/sound2.gif) | 262_Tafseer_Suratul_..> | 2019-08-31 16:26 | 4.4M | |
![[SND]](/icons/sound2.gif) | 263_Tafseer_Suratul_..> | 2019-08-31 16:26 | 3.9M | |
![[SND]](/icons/sound2.gif) | 264_Tafseer_Suratul_..> | 2019-08-31 16:26 | 3.3M | |
![[SND]](/icons/sound2.gif) | 265_Tafseer_Suratul_..> | 2019-08-31 16:26 | 5.0M | |
![[SND]](/icons/sound2.gif) | 266_Tafseer_Suratul_..> | 2019-08-31 16:26 | 6.1M | |
![[SND]](/icons/sound2.gif) | 267_Tafseer_Suratul_..> | 2019-08-31 16:26 | 5.2M | |
![[SND]](/icons/sound2.gif) | 268_Takmeele_Ramadan..> | 2019-08-31 16:26 | 4.4M | |
![[SND]](/icons/sound2.gif) | 269_MAJLIS_KA_TAARUF..> | 2019-08-31 16:26 | 5.5M | |
![[SND]](/icons/sound2.gif) | 270_Hubb_e_Elahi_hal..> | 2019-08-31 16:26 | 5.1M | |
![[SND]](/icons/sound2.gif) | 271_Hubb_e_Elahi_hal..> | 2019-08-31 16:26 | 6.7M | |
![[SND]](/icons/sound2.gif) | 272_Hubb_e_Elahi_hal..> | 2019-08-31 16:26 | 6.8M | |
![[SND]](/icons/sound2.gif) | 273_ASHRA_E_ZILHAJJA..> | 2019-08-31 16:26 | 6.4M | |
![[SND]](/icons/sound2.gif) | 274_Hubb_e_Elahi_hal..> | 2019-08-31 16:26 | 6.5M | |
![[SND]](/icons/sound2.gif) | 275_Hubb_e_Elahi_hal..> | 2019-08-31 16:26 | 7.5M | |
![[SND]](/icons/sound2.gif) | 276_Hubb_e_Elahi_hal..> | 2019-08-31 16:26 | 8.3M | |
![[SND]](/icons/sound2.gif) | 278_Hubb_e_Elahi_ke_..> | 2019-08-31 16:26 | 6.0M | |
![[SND]](/icons/sound2.gif) | 282_Zikr_ki_kasrat_s..> | 2019-08-31 16:26 | 7.1M | |
![[SND]](/icons/sound2.gif) | 283_Umar_e_Taveel_au..> | 2019-08-31 16:26 | 8.1M | |
![[SND]](/icons/sound2.gif) | 285_M_M_TAQI_USMANI_..> | 2019-08-31 16:26 | 8.4M | |
![[SND]](/icons/sound2.gif) | 288_M_M_TAQI_ZIKR_E_..> | 2019-08-31 16:26 | 8.6M | |
![[SND]](/icons/sound2.gif) | 289_Zulmat_O_Ghaflat..> | 2019-08-31 16:26 | 7.5M | |
![[SND]](/icons/sound2.gif) | 290_M_M_TAQI_TASBEEH..> | 2019-08-31 16:26 | 10M | |
![[SND]](/icons/sound2.gif) | 291_Ghunah_Zehar_hai..> | 2019-08-31 16:26 | 8.5M | |
![[SND]](/icons/sound2.gif) | 292_NAMAZ_DEENEISLAM..> | 2019-08-31 16:26 | 6.5M | |
![[SND]](/icons/sound2.gif) | 294_MUFTI_M_TAQI_Eht..> | 2019-08-31 16:26 | 6.4M | |
![[SND]](/icons/sound2.gif) | 295_Ramadan_aur_Raah..> | 2019-08-31 16:26 | 7.6M | |
![[SND]](/icons/sound2.gif) | 296_MUFTI_M_TAQI_GHE..> | 2019-08-31 16:26 | 7.9M | |
![[SND]](/icons/sound2.gif) | 297_KI_HOI_GHEEBAT_K..> | 2019-08-31 16:26 | 7.5M | |
![[SND]](/icons/sound2.gif) | 298_EFTARA_O_TAJASSU..> | 2019-08-31 16:26 | 7.7M | |
![[SND]](/icons/sound2.gif) | 299_BAD GHUMANI_AUR_..> | 2019-08-31 16:26 | 5.7M | |
![[SND]](/icons/sound2.gif) | 300_TAJASSUS_AUR_TAH..> | 2019-08-31 16:26 | 8.6M | |
![[SND]](/icons/sound2.gif) | 301_KIBIR_AUR_KHUDRA..> | 2019-08-31 16:26 | 6.9M | |
![[SND]](/icons/sound2.gif) | 302_GHUSSA_KI_BUNIYA..> | 2019-08-31 16:26 | 6.6M | |
![[SND]](/icons/sound2.gif) | 303_TAZKEYA E NAFS_A..> | 2019-08-31 16:26 | 8.1M | |
![[SND]](/icons/sound2.gif) | 304_PUR_FITN_DAUR_MA..> | 2019-08-31 16:26 | 8.8M | |
![[SND]](/icons/sound2.gif) | 305_Pur_Fitn_mahul_m..> | 2019-08-31 16:26 | 7.8M | |
![[SND]](/icons/sound2.gif) | 306_Rajuo_elallah_ki..> | 2019-08-31 16:26 | 5.8M | |
![[SND]](/icons/sound2.gif) | 307_Takbeer_ko_pheel..> | 2019-08-31 16:26 | 6.3M | |
![[SND]](/icons/sound2.gif) | 308_Har_Shakhs_Apni_..> | 2019-08-31 16:26 | 7.7M | |
![[SND]](/icons/sound2.gif) | 308_Har_shakhs_Apni_..> | 2019-08-31 16:26 | 7.6M | |
![[SND]](/icons/sound2.gif) | 309_Haal_ko_Ghanimat..> | 2019-08-31 16:26 | 9.4M | |
![[SND]](/icons/sound2.gif) | 310_Aheed_ki_pasdari..> | 2019-08-31 16:26 | 7.3M | |
![[SND]](/icons/sound2.gif) | 311_Zindagi_Ek_hamaa..> | 2019-08-31 16:26 | 9.0M | |
![[SND]](/icons/sound2.gif) | 312_Ezhar_e_Tashakku..> | 2019-08-31 16:26 | 7.8M | |
![[SND]](/icons/sound2.gif) | 313_Shukr_Ghuzar_Ban..> | 2019-08-31 16:26 | 7.9M | |
![[SND]](/icons/sound2.gif) | 314_Jazba e Entaiqaa..> | 2019-08-31 16:26 | 7.0M | |
![[SND]](/icons/sound2.gif) | 315_jab_ kisi_ komta..> | 2019-08-31 16:26 | 7.7M | |
![[SND]](/icons/sound2.gif) | 315_jab_ kisi_ komta..> | 2019-08-31 16:26 | 7.7M | |
![[SND]](/icons/sound2.gif) | 316_sabar_O_shukr 21..> | 2019-08-31 16:26 | 9.0M | |
![[SND]](/icons/sound2.gif) | 317_Estadraaj_dheel_..> | 2019-08-31 16:26 | 8.6M | |
![[SND]](/icons/sound2.gif) | 318_Najaat_ka_Daarom..> | 2019-08-31 16:26 | 8.9M | |
![[SND]](/icons/sound2.gif) | 319_Chaar_Neyamatun_..> | 2019-08-31 16:26 | 5.8M | |
![[SND]](/icons/sound2.gif) | 320_Shukr_ezafi_ ney..> | 2019-08-31 16:26 | 7.5M | |
![[SND]](/icons/sound2.gif) | 321_Iman_ sabar_O_ s..> | 2019-08-31 16:26 | 8.6M | |
![[SND]](/icons/sound2.gif) | 322_ 2 -Cheez_ki_ hi..> | 2019-08-31 16:26 | 9.3M | |
![[SND]](/icons/sound2.gif) | 323_3_Shethani_khasa..> | 2019-08-31 16:26 | 9.4M | |
![[SND]](/icons/sound2.gif) | 324_3_ghunah_e_kabee..> | 2019-08-31 16:26 | 8.4M | |
![[SND]](/icons/sound2.gif) | 325_ Lughon_ki_ taar..> | 2019-08-31 16:26 | 8.3M | |
![[SND]](/icons/sound2.gif) | 327_Maqsad_e_Ramadan..> | 2019-08-31 16:26 | 11M | |
![[SND]](/icons/sound2.gif) | 328_Zikr_ke_ fawayed..> | 2019-08-31 16:26 | 7.3M | |
![[SND]](/icons/sound2.gif) | 329_MUFTI_MUHAMMAD_T..> | 2019-08-31 16:26 | 9.4M | |
![[SND]](/icons/sound2.gif) | 330_Amal_e_ Zahera_O..> | 2019-08-31 16:26 | 5.9M | |
![[SND]](/icons/sound2.gif) | 331_MUFTI_TAQI_USMAN..> | 2019-08-31 16:26 | 8.3M | |
![[SND]](/icons/sound2.gif) | 332_Khushoo_k_Darjay..> | 2019-08-31 16:26 | 7.1M | |
![[SND]](/icons/sound2.gif) | 333_Khushoo_ke_Darja..> | 2019-08-31 16:26 | 9.3M | |
![[SND]](/icons/sound2.gif) | 334_ Khushoo_ke_ Dar..> | 2019-08-31 16:26 | 53M | |
![[SND]](/icons/sound2.gif) | 335_Ekhlas_ki_Haqeeq..> | 2019-08-31 16:26 | 8.1M | |
![[SND]](/icons/sound2.gif) | 336_Ekhlas_ki_Haqeeq..> | 2019-08-31 16:26 | 7.8M | |
![[SND]](/icons/sound2.gif) | 337_TASAO'OF_KIHAQEQ..> | 2019-08-31 16:26 | 8.8M | |
![[SND]](/icons/sound2.gif) | 338_MUFTI_MUHAMMAD_T..> | 2019-08-31 16:26 | 3.7M | |
![[SND]](/icons/sound2.gif) | 339_MUFTI_MUHAMMAD_T..> | 2019-08-31 16:26 | 6.9M | |
![[SND]](/icons/sound2.gif) | 340_Deendari_ki_ Tam..> | 2019-08-31 16:26 | 7.9M | |
![[SND]](/icons/sound2.gif) | 342_Mulki_ halat_ka_..> | 2019-08-31 16:26 | 6.7M | |
![[SND]](/icons/sound2.gif) | 344_Baesat_ka_chaar_..> | 2019-08-31 16:26 | 7.9M | |
![[SND]](/icons/sound2.gif) | 344_Maqasad_e_Baesat..> | 2019-08-31 16:26 | 6.9M | |
![[SND]](/icons/sound2.gif) | 345_NIKAH_ZINDAGI_KA..> | 2019-08-31 16:26 | 6.7M | |
![[SND]](/icons/sound2.gif) | 346_DEOBANDEYAT_MAA_..> | 2019-08-31 16:27 | 9.7M | |
![[SND]](/icons/sound2.gif) | 347_EKRAM_E_MUSLIM_ ..> | 2019-08-31 16:27 | 7.6M | |
![[SND]](/icons/sound2.gif) | 348_Itaat_me_noor, M..> | 2019-08-31 16:27 | 8.3M | |
![[SND]](/icons/sound2.gif) | 349_ ESTAIQAMAT_KERA..> | 2019-08-31 16:27 | 7.8M | |
![[SND]](/icons/sound2.gif) | 350_MAQSAD_E_ASALI_ ..> | 2019-08-31 16:27 | 9.2M | |
![[SND]](/icons/sound2.gif) | 351_GHUNAH_ZEHR,_ TA..> | 2019-08-31 16:27 | 8.9M | |
![[SND]](/icons/sound2.gif) | 352_HADEYA_DENAY_KE_..> | 2019-08-31 16:27 | 9.7M | |
![[SND]](/icons/sound2.gif) | 353_RAAH_E_SULUK_KE_..> | 2019-08-31 16:27 | 9.6M | |
![[SND]](/icons/sound2.gif) | 354_ TASAWWF_KI_HAQE..> | 2019-08-31 16:27 | 9.1M | |
![[SND]](/icons/sound2.gif) | 356_Dil,Fikr_O_Nazar..> | 2019-08-31 16:27 | 11M | |
![[SND]](/icons/sound2.gif) | 357_uswayee_hasna_ta..> | 2019-08-31 16:27 | 9.3M | |
![[SND]](/icons/sound2.gif) | 358_Duniya_ki_besaba..> | 2019-08-31 16:27 | 15M | |
![[SND]](/icons/sound2.gif) | 359_Ramadan Bandegi ..> | 2019-08-31 16:27 | 12M | |
![[SND]](/icons/sound2.gif) | 372_Suhbat_e_saleh_m..> | 2019-08-31 16:27 | 6.3M | |
![[SND]](/icons/sound2.gif) | 373_Suhbat_ ki_ taas..> | 2019-08-31 16:27 | 8.5M | |
![[SND]](/icons/sound2.gif) | 374_Ghunah_zehr_hai_..> | 2019-08-31 16:27 | 9.5M | |
![[SND]](/icons/sound2.gif) | 375_Taubah_nasooh_az..> | 2019-08-31 16:27 | 11M | |
![[SND]](/icons/sound2.gif) | 376_Taubah_aur_Estai..> | 2019-08-31 16:27 | 6.5M | |
![[SND]](/icons/sound2.gif) | 377_Shaan_e_kibriyai..> | 2019-08-31 16:27 | 7.8M | |
![[SND]](/icons/sound2.gif) | 377_Shaan_e_kibriyai..> | 2019-08-31 16:27 | 6.8M | |
![[SND]](/icons/sound2.gif) | 378_Allah_ Taulae_ji..> | 2019-08-31 16:27 | 8.4M | |
![[SND]](/icons/sound2.gif) | 379_Khushow_Khuzow_k..> | 2019-08-31 16:27 | 8.8M | |
![[SND]](/icons/sound2.gif) | 380_Usul_e_ Elallah_..> | 2019-08-31 16:27 | 7.7M | |
![[SND]](/icons/sound2.gif) | 381_Haqooq_e_Muslemi..> | 2019-08-31 16:27 | 7.2M | |
![[SND]](/icons/sound2.gif) | 382_Assalamu alaikum..> | 2019-08-31 16:27 | 7.6M | |
![[SND]](/icons/sound2.gif) | 383_Salam-o_kalam_k_..> | 2019-08-31 16:27 | 7.1M | |
![[SND]](/icons/sound2.gif) | 384_Namaz_ tareeq_e_..> | 2019-08-31 16:27 | 8.3M | |
![[SND]](/icons/sound2.gif) | 385_Deen_ etteba_e_ ..> | 2019-08-31 16:27 | 7.8M | |
![[SND]](/icons/sound2.gif) | 387_Eslah_e_Nafs_k_l..> | 2019-08-31 16:27 | 10M | |
![[SND]](/icons/sound2.gif) | 388_Ghussah_se_Jazba..> | 2019-08-31 16:27 | 9.1M | |
![[SND]](/icons/sound2.gif) | 389_Mujahida_O_Muhas..> | 2019-08-31 16:27 | 7.7M | |
![[SND]](/icons/sound2.gif) | 390_Tazkera_O_Naseeh..> | 2019-08-31 16:27 | 7.3M | |
![[SND]](/icons/sound2.gif) | 391_Tazkeya_e_Zahera..> | 2019-08-31 16:27 | 9.0M | |
![[SND]](/icons/sound2.gif) | 392_Takabbur_ke_Aqsa..> | 2019-08-31 16:27 | 9.9M | |
![[SND]](/icons/sound2.gif) | 393_Kibr_ke_Aqsaam_a..> | 2019-08-31 16:27 | 11M | |
![[SND]](/icons/sound2.gif) | 394_Imam_Bukhari_ka_..> | 2019-08-31 16:27 | 9.8M | |
![[SND]](/icons/sound2.gif) | 395_Tawazuo-ki_Haqee..> | 2019-08-31 16:27 | 12M | |
![[SND]](/icons/sound2.gif) | 396_Estaiqbal_e_Rama..> | 2019-08-31 16:27 | 10M | |
![[SND]](/icons/sound2.gif) | 397_Sabar_Mujassimah..> | 2019-08-31 16:27 | 16M | |
![[SND]](/icons/sound2.gif) | 398_Sabar_ aur_sabet..> | 2019-08-31 16:27 | 15M | |
![[SND]](/icons/sound2.gif) | 399_Sabar_ aur_Sabet..> | 2019-08-31 16:27 | 6.4M | |
![[SND]](/icons/sound2.gif) | 400_Sabar_ aur_Sabet..> | 2019-08-31 16:27 | 8.9M | |
![[SND]](/icons/sound2.gif) | 401_Sabar_ aur_Sabet..> | 2019-08-31 16:27 | 6.2M | |
![[SND]](/icons/sound2.gif) | 402_Aday_e_Haqooq_au..> | 2019-08-31 16:27 | 13M | |
![[SND]](/icons/sound2.gif) | 403_Sabar-anil_maase..> | 2019-08-31 16:27 | 8.5M | |
![[SND]](/icons/sound2.gif) | 404_Dawat_O_Tabligh_..> | 2019-08-31 16:27 | 7.9M | |
![[SND]](/icons/sound2.gif) | 405_Sabar_Aalau_Darj..> | 2019-08-31 16:27 | 16M | |
![[SND]](/icons/sound2.gif) | 406__Shukr_ aur_Esta..> | 2019-08-31 16:27 | 13M | |
![[SND]](/icons/sound2.gif) | 407_Ettaat_O_Ebaadat..> | 2019-08-31 16:27 | 11M | |
![[SND]](/icons/sound2.gif) | 408_Firaq_e_Batelah_..> | 2019-08-31 16:27 | 15M | |
![[SND]](/icons/sound2.gif) | 409_Khushow_hasel_ka..> | 2019-08-31 16:27 | 13M | |
![[SND]](/icons/sound2.gif) | 411_Bela_ Onwan 14_1..> | 2019-08-31 16:27 | 26M | |
![[SND]](/icons/sound2.gif) | 412_Tafakkur_kis_was..> | 2019-08-31 16:27 | 21M | |
![[SND]](/icons/sound2.gif) | 413_Neyamat_ki_Qadar..> | 2019-08-31 16:27 | 23M | |
![[SND]](/icons/sound2.gif) | 414_Zikr_O_ Dua_se_D..> | 2019-08-31 16:27 | 14M | |
![[SND]](/icons/sound2.gif) | 415_Dil_O_ Nighah_ M..> | 2019-08-31 16:27 | 14M | |
![[SND]](/icons/sound2.gif) | 416_Mahboob-amal_ Mu..> | 2019-08-31 16:27 | 13M | |
![[SND]](/icons/sound2.gif) | 417_Ghum_wa_Museebat..> | 2019-08-31 16:27 | 23M | |
![[SND]](/icons/sound2.gif) | 418_Ibaadat_maqsad_h..> | 2019-08-31 16:27 | 9.5M | |
![[SND]](/icons/sound2.gif) | 419_Sehat_wa_Tandura..> | 2019-08-31 16:27 | 12M | |
![[SND]](/icons/sound2.gif) | 420_Ramadan_ka_Taqad..> | 2019-08-31 16:27 | 7.2M | |
![[SND]](/icons/sound2.gif) | 422_Mufti Muhamamd T..> | 2019-08-31 16:27 | 5.5M | |
![[SND]](/icons/sound2.gif) | 423_Muft Muhamamd Ta..> | 2019-08-31 16:27 | 5.3M | |
![[SND]](/icons/sound2.gif) | 423_Muft Muhamamd Ta..> | 2019-08-31 16:27 | 6.1M | |
![[SND]](/icons/sound2.gif) | 425_Khosoo, Khozo, M..> | 2019-08-31 16:27 | 2.9M | |
![[SND]](/icons/sound2.gif) | 426_Haqeqat E Khasho..> | 2019-08-31 16:27 | 7.3M | |
![[SND]](/icons/sound2.gif) | 427_Taobah Ki Haqeqa..> | 2019-08-31 16:27 | 3.2M | |
![[SND]](/icons/sound2.gif) | 428_Mufti_Muhammad T..> | 2019-08-31 16:27 | 6.0M | |
![[SND]](/icons/sound2.gif) | 428_Mufti_Muhammad T..> | 2019-08-31 16:27 | 6.1M | |
![[SND]](/icons/sound2.gif) | 429_Ghunah Simm E Qa..> | 2019-08-31 16:27 | 6.3M | |
![[SND]](/icons/sound2.gif) | 430_Taobah Nadamat O..> | 2019-08-31 16:27 | 5.8M | |
![[SND]](/icons/sound2.gif) | 431_Moamolat key Mut..> | 2019-08-31 16:27 | 9.1M | |
![[SND]](/icons/sound2.gif) | 432_Istamrar E Tobah..> | 2019-08-31 16:27 | 13M | |
![[SND]](/icons/sound2.gif) | 433_Estehzaar_e_Neyy..> | 2019-08-31 16:27 | 5.2M | |
![[SND]](/icons/sound2.gif) | 434_Ebteda e Amal_me..> | 2019-08-31 16:27 | 6.0M | |
![[SND]](/icons/sound2.gif) | 435_Ikhlaas_ke_Darja..> | 2019-08-31 16:27 | 5.0M | |
![[SND]](/icons/sound2.gif) | 436_Ikhlas_ka_Aaulaa..> | 2019-08-31 16:27 | 5.5M | |
![[SND]](/icons/sound2.gif) | 437_Riyaa_ki_Haqeeqa..> | 2019-08-31 16:27 | 4.4M | |
![[SND]](/icons/sound2.gif) | 438_Haqeeqat_e_Aafat..> | 2019-08-31 16:27 | 5.6M | |
![[SND]](/icons/sound2.gif) | 440_kisi_ki_Ehanat_T..> | 2019-08-31 16:27 | 4.8M | |
![[SND]](/icons/sound2.gif) | 2012-06-23TheReviver..> | 2019-08-31 16:26 | 7.4M | |
![[SND]](/icons/sound2.gif) | 2012-06-24MuftiTaqiU..> | 2019-08-31 16:26 | 6.4M | |
![[SND]](/icons/sound2.gif) | 2012-06-25EnglishBay..> | 2019-08-31 16:26 | 3.6M | |
![[SND]](/icons/sound2.gif) | 2012-06-25KhatmeBukh..> | 2019-08-31 16:26 | 3.9M | |
![[SND]](/icons/sound2.gif) | 2016-07-30-Khatme-Bu..> | 2019-08-31 16:26 | 8.1M | |
![[SND]](/icons/sound2.gif) | 2016-07-31-Bayan-for..> | 2019-08-31 16:26 | 7.7M | |
![[SND]](/icons/sound2.gif) | 2016-08-02-Khatme-Bu..> | 2019-08-31 16:26 | 11M | |
![[SND]](/icons/sound2.gif) | 2016-08-03-ulamConfe..> | 2019-08-31 16:26 | 8.4M | |
![[SND]](/icons/sound2.gif) | Aadab O Ikram Mehman..> | 2019-08-31 16:27 | 9.2M | |
![[SND]](/icons/sound2.gif) | Aadabul Muasherat Ha..> | 2019-08-31 16:27 | 8.9M | |
![[SND]](/icons/sound2.gif) | Aadabul Muasherat_Aa..> | 2019-08-31 16:27 | 9.7M | |
![[SND]](/icons/sound2.gif) | Aafiyat sarchashma n..> | 2019-08-31 16:27 | 10M | |
![[SND]](/icons/sound2.gif) | Aamal_ka_Daromadar_n..> | 2019-08-31 16:27 | 8.1M | |
![[SND]](/icons/sound2.gif) | Aamal ki Rooh Imaan..> | 2019-08-31 16:27 | 12M | |
![[SND]](/icons/sound2.gif) | Aamal ki kaarAamad I..> | 2019-08-31 16:27 | 11M | |
![[SND]](/icons/sound2.gif) | Aamal ki kaarAamad I..> | 2019-08-31 16:27 | 12M | |
![[SND]](/icons/sound2.gif) | Aamal ki kaarAamad I..> | 2019-08-31 16:27 | 7.5M | |
![[SND]](/icons/sound2.gif) | Aayat e kareema ki D..> | 2019-08-31 16:27 | 12M | |
![[SND]](/icons/sound2.gif) | Aaza e jawarah Neyam..> | 2019-08-31 16:27 | 8.6M | |
![[SND]](/icons/sound2.gif) | Ada e haqooq hifz e ..> | 2019-08-31 16:27 | 9.8M | |
![[SND]](/icons/sound2.gif) | Allah Tala TakPohach..> | 2019-08-31 16:27 | 8.8M | |
![[SND]](/icons/sound2.gif) | Allah Tala TakPohach..> | 2019-08-31 16:27 | 10M | |
![[SND]](/icons/sound2.gif) | Allah Walon Ki Suhba..> | 2019-08-31 16:27 | 14M | |
![[SND]](/icons/sound2.gif) | Amal E Saliha, Qurb ..> | 2019-08-31 16:27 | 12M | |
![[SND]](/icons/sound2.gif) | Amal_ki_eslah,dusray..> | 2019-08-31 16:27 | 4.9M | |
![[SND]](/icons/sound2.gif) | Apni eslah ki fikr P..> | 2023-01-03 04:59 | 13M | |
![[SND]](/icons/sound2.gif) | Arsh_k_sayay_talay.wma | 2019-08-31 16:27 | 9.5M | |
![[SND]](/icons/sound2.gif) | Ashra e Akheera - Ab..> | 2019-08-31 16:27 | 4.6M | |
![[SND]](/icons/sound2.gif) | Ashra e Zilhajjah sh..> | 2019-08-31 16:27 | 9.0M | |
![[SND]](/icons/sound2.gif) | Ashra e zilhajjah Ta..> | 2019-08-31 16:27 | 15M | |
![[SND]](/icons/sound2.gif) | Ayyam E Zeul Hajjah ..> | 2019-08-31 16:27 | 5.7M | |
![[SND]](/icons/sound2.gif) | Bajor Saniha Alamnak..> | 2023-08-05 07:02 | 13M | |
![[SND]](/icons/sound2.gif) | Bakhshish-O-Mughfira..> | 2019-08-31 16:27 | 11M | |
![[SND]](/icons/sound2.gif) | Bandegi aur Abdeyyat..> | 2019-08-31 16:27 | 9.6M | |
![[SND]](/icons/sound2.gif) | Barakat ki Dil Nashe..> | 2022-04-11 06:11 | 6.7M | |
![[SND]](/icons/sound2.gif) | Bayaan e Jumaa 6th K..> | 2022-02-24 06:21 | 7.2M | |
![[SND]](/icons/sound2.gif) | Bayan & Dua For Takm..> | 2024-04-14 05:20 | 14M | |
![[SND]](/icons/sound2.gif) | Bayan-e-Juma_Mufti M..> | 2019-08-31 16:27 | 3.2M | |
![[SND]](/icons/sound2.gif) | Bayan Maputo_ Mozamb..> | 2025-08-02 08:02 | 11M | |
![[SND]](/icons/sound2.gif) | Bayan On Opretion Bu..> | 2025-05-18 06:06 | 3.0M | |
![[SND]](/icons/sound2.gif) | Bayan_Mufti_Mohammad..> | 2019-08-31 16:27 | 17M | |
![[SND]](/icons/sound2.gif) | Be Mauqah Ghussah ki..> | 2020-01-05 03:03 | 5.3M | |
![[SND]](/icons/sound2.gif) | Bhaion ! Fisq_O_Fuju..> | 2019-08-31 16:27 | 8.6M | |
![[SND]](/icons/sound2.gif) | Bimari Maut k liye A..> | 2019-08-31 16:27 | 7.6M | |
![[SND]](/icons/sound2.gif) | Bimari aur Tabyee Ha..> | 2019-08-31 16:27 | 4.8M | |
![[SND]](/icons/sound2.gif) | Bimari aur Tabyee ha..> | 2019-08-31 16:27 | 10M | |
![[SND]](/icons/sound2.gif) | Bimari aur Tabyee ha..> | 2019-08-31 16:27 | 12M | |
![[SND]](/icons/sound2.gif) | Burma_Ke_ Musalman_a..> | 2019-08-31 16:27 | 14M | |
![[SND]](/icons/sound2.gif) | Chughli Se Bachein, ..> | 2019-08-31 16:27 | 6.6M | |
![[SND]](/icons/sound2.gif) | Cut341_Sehat_O_Omar_..> | 2019-08-31 16:27 | 5.5M | |
![[SND]](/icons/sound2.gif) | Cut343_Elm_nai_pukar..> | 2019-08-31 16:27 | 6.6M | |
![[SND]](/icons/sound2.gif) | Dard E Dil Key Liay ..> | 2019-08-31 16:27 | 8.5M | |
![[SND]](/icons/sound2.gif) | Dars,Naseehat,_KHATM..> | 2019-08-31 16:27 | 8.5M | |
![[SND]](/icons/sound2.gif) | Deen Ka Bunyadi Elm ..> | 2023-08-20 08:02 | 15M | |
![[SND]](/icons/sound2.gif) | Deen Me Mua'mlat Ki ..> | 2025-07-14 04:30 | 5.8M | |
![[SND]](/icons/sound2.gif) | Dua-Allah-se-qurbat-..> | 2019-08-31 16:27 | 8.6M | |
![[SND]](/icons/sound2.gif) | Duaa Ki Fazilat_Muft..> | 2019-08-31 16:27 | 11M | |
![[SND]](/icons/sound2.gif) | Duaa Mufti Mohammad ..> | 2020-03-16 05:10 | 9.8M | |
![[SND]](/icons/sound2.gif) | Duaa wa shukr Zaher ..> | 2019-08-31 16:27 | 13M | |
![[SND]](/icons/sound2.gif) | Duniyawi zindagi Jah..> | 2019-08-31 16:27 | 8.9M | |
![[SND]](/icons/sound2.gif) | Dunun Jeahn k liye I..> | 2019-08-31 16:27 | 9.0M | |
![[SND]](/icons/sound2.gif) | Dunun Jehan k liye I..> | 2019-08-31 16:27 | 10M | |
![[SND]](/icons/sound2.gif) | ESlah ka muasser Tar..> | 2023-01-26 03:56 | 12M | |
![[SND]](/icons/sound2.gif) | ESlah ka muasser Tar..> | 2023-02-10 13:03 | 14M | |
![[SND]](/icons/sound2.gif) | ESlah ka muasser Tar..> | 2023-01-24 13:05 | 14M | |
![[SND]](/icons/sound2.gif) | ESlah ka muasser Tar..> | 2022-12-29 03:55 | 15M | |
![[SND]](/icons/sound2.gif) | ESlah ka muasser Tar..> | 2023-01-12 06:13 | 12M | |
![[SND]](/icons/sound2.gif) | Ebaadat me Zauq Shau..> | 2019-08-31 16:27 | 8.8M | |
![[SND]](/icons/sound2.gif) | Eid_me_bakhshish_aur..> | 2019-08-31 16:27 | 10M | |
![[SND]](/icons/sound2.gif) | Eidhaatul Maal Mamno..> | 2019-08-31 16:27 | 7.1M | |
![[SND]](/icons/sound2.gif) | Eidul Fitr Shukr aur..> | 2019-08-31 16:27 | 7.4M | |
![[SND]](/icons/sound2.gif) | Eifaa e Ahed ki Diln..> | 2019-08-31 16:27 | 8.8M | |
![[SND]](/icons/sound2.gif) | Eifaa e Ahed par be ..> | 2019-08-31 16:27 | 8.7M | |
![[SND]](/icons/sound2.gif) | Eisaar wa Tahammul M..> | 2019-08-31 16:27 | 11M | |
![[SND]](/icons/sound2.gif) | English Lencture to ..> | 2020-01-08 14:40 | 5.6M | |
![[SND]](/icons/sound2.gif) | Enkesaar e Tabyee Mu..> | 2019-08-31 16:27 | 11M | |
![[SND]](/icons/sound2.gif) | Enkesaar e Tabyee au..> | 2019-08-31 16:27 | 9.3M | |
![[SND]](/icons/sound2.gif) | Esteghfar aur Shukar..> | 2019-08-31 16:27 | 8.6M | |
![[SND]](/icons/sound2.gif) | Esteqaamat_Azeem_Sun..> | 2019-08-31 16:27 | 8.1M | |
![[SND]](/icons/sound2.gif) | Ettebah e Sunnat_Ban..> | 2019-08-31 16:27 | 9.8M | |
![[SND]](/icons/sound2.gif) | Filastin Aur Ummat e..> | 2023-11-05 02:40 | 12M | |
![[SND]](/icons/sound2.gif) | Fitno Kay Is Dor Mai..> | 2019-08-31 16:27 | 4.6M | |
![[SND]](/icons/sound2.gif) | Gheebat Jurm e Azeem..> | 2019-08-31 16:27 | 12M | |
![[SND]](/icons/sound2.gif) | Gheebat Muhlak Bimar..> | 2019-08-31 16:27 | 6.9M | |
![[SND]](/icons/sound2.gif) | Gheebat_ki_Hurmat_au..> | 2019-08-31 16:27 | 11M | |
![[SND]](/icons/sound2.gif) | Gheebat sangheen Ghu..> | 2020-01-25 03:11 | 5.3M | |
![[SND]](/icons/sound2.gif) | Ghunah Zehr aur Taub..> | 2019-08-31 16:27 | 13M | |
![[SND]](/icons/sound2.gif) | Ghuzzah Ka Eilaj Maw..> | 2019-08-31 16:27 | 6.2M | |
![[SND]](/icons/sound2.gif) | Gunahun Se Bachna Na..> | 2023-04-18 05:05 | 12M | |
![[ ]](/icons/unknown.gif) | Gunahun Se Bachney k..> | 2023-04-18 04:13 | 15M | |
![[SND]](/icons/sound2.gif) | Haaleyah safar me uq..> | 2019-08-31 16:27 | 15M | |
![[SND]](/icons/sound2.gif) | Hadees-e-Jibraeel-ki..> | 2019-08-31 16:27 | 7.5M | |
![[SND]](/icons/sound2.gif) | Hadith_e_Musalasal_y..> | 2019-08-31 16:27 | 4.8M | |
![[SND]](/icons/sound2.gif) | Hajj Ki Ibadat Aur U..> | 2019-08-31 16:27 | 3.7M | |
![[SND]](/icons/sound2.gif) | Hajj Ky Baad Zindagi..> | 2025-07-14 04:04 | 6.2M | |
![[SND]](/icons/sound2.gif) | Hal Ko Ghanimat or M..> | 2019-08-31 16:27 | 4.6M | |
![[SND]](/icons/sound2.gif) | Hamas ka Israel par ..> | 2023-10-21 04:46 | 3.8M | |
![[SND]](/icons/sound2.gif) | Haqeeqat_e_439_Aafat..> | 2019-08-31 16:27 | 5.8M | |
![[SND]](/icons/sound2.gif) | Haqeeqat_e_Muhabbat_..> | 2019-08-31 16:27 | 13M | |
![[SND]](/icons/sound2.gif) | Har Duaa me hamaray ..> | 2022-09-28 13:20 | 13M | |
![[SND]](/icons/sound2.gif) | Har haal me Allah ka..> | 2022-05-01 04:20 | 11M | |
![[SND]](/icons/sound2.gif) | Harmain Ki Ziarat Al..> | 2019-08-31 16:27 | 9.8M | |
![[SND]](/icons/sound2.gif) | Hasad_ka_Izalah_kare..> | 2019-08-31 16:27 | 4.6M | |
![[SND]](/icons/sound2.gif) | Hub_Ilahi_K_Hasool_M..> | 2019-08-31 16:27 | 7.0M | |
![[SND]](/icons/sound2.gif) | Hubb e MaaAllah Muft..> | 2022-03-28 15:07 | 7.2M | |
![[SND]](/icons/sound2.gif) | Hukm e Baari Taula h..> | 2019-08-31 16:27 | 7.6M | |
![[SND]](/icons/sound2.gif) | Hurmat e Aqsa Conven..> | 2023-12-07 04:23 | 7.5M | |
![[SND]](/icons/sound2.gif) | Hurmat e Aqsa Ulama ..> | 2024-01-16 04:34 | 10M | |
![[SND]](/icons/sound2.gif) | Hurmat wale aur Hajj..> | 2025-06-11 06:13 | 5.8M | |
![[SND]](/icons/sound2.gif) | Ibaadat aur Qurb e k..> | 2019-08-31 16:27 | 11M | |
![[SND]](/icons/sound2.gif) | Ijlas Majlis e A'ami..> | 2024-12-17 17:29 | 6.3M | |
![[SND]](/icons/sound2.gif) | Ikhtilaf Door Karny ..> | 2024-12-09 06:07 | 13M | |
![[SND]](/icons/sound2.gif) | Imaan Laa zawal Neya..> | 2019-08-31 16:27 | 11M | |
![[SND]](/icons/sound2.gif) | Iman_ko_ Qabar_tak_ ..> | 2019-08-31 16:27 | 9.2M | |
![[SND]](/icons/sound2.gif) | Insaan ke Aamal ko B..> | 2019-11-30 03:08 | 5.7M | |
![[SND]](/icons/sound2.gif) | Insan Ki Khidmat Taa..> | 2019-08-31 16:27 | 12M | |
![[SND]](/icons/sound2.gif) | Islaah me Rukawt 03_..> | 2019-08-31 16:27 | 9.3M | |
![[SND]](/icons/sound2.gif) | Islah_ke-4-Tareeqay ..> | 2019-08-31 16:27 | 6.9M | |
![[ ]](/icons/unknown.gif) | Islah e Muashray Ka ..> | 2023-10-08 10:50 | 15M | |
![[SND]](/icons/sound2.gif) | Israeli Jangi Jaraim..> | 2023-10-28 10:33 | 13M | |
![[SND]](/icons/sound2.gif) | Israf Key Aqsaam_Muf..> | 2019-08-31 16:27 | 5.6M | |
![[SND]](/icons/sound2.gif) | Itteba e Nabwi Hubb ..> | 2019-08-31 16:27 | 11M | |
![[SND]](/icons/sound2.gif) | Jaanwarun ko Insaan ..> | 2019-08-31 16:27 | 10M | |
![[SND]](/icons/sound2.gif) | Jahannum Se Azadi Ka..> | 2019-08-31 16:27 | 4.1M | |
![[SND]](/icons/sound2.gif) | Jalsa Dastar Bandi _..> | 2025-01-25 05:24 | 15M | |
![[SND]](/icons/sound2.gif) | Jalsa Dastar Bandi _..> | 2025-01-12 04:30 | 5.9M | |
![[ ]](/icons/unknown.gif) | Jamaa Masjid Leicest..> | 2020-01-13 03:10 | 12M | |
![[SND]](/icons/sound2.gif) | Jamae aur muassar ni..> | 2019-08-31 16:27 | 5.3M | |
![[SND]](/icons/sound2.gif) | Jamiatur Rasheed Muf..> | 2019-08-31 16:27 | 5.0M | |
![[SND]](/icons/sound2.gif) | Jhoot Adiyaan E Bati..> | 2019-08-31 16:27 | 5.5M | |
![[SND]](/icons/sound2.gif) | Jihad Fi Sabilillah ..> | 2023-12-23 14:03 | 11M | |
![[SND]](/icons/sound2.gif) | Kasrat E Duaa O Kasr..> | 2019-08-31 16:27 | 6.7M | |
![[SND]](/icons/sound2.gif) | Khair E Ummat ka Laq..> | 2022-02-27 07:34 | 7.2M | |
![[SND]](/icons/sound2.gif) | Khair E Ummat ka Laq..> | 2022-02-27 06:06 | 7.7M | |
![[SND]](/icons/sound2.gif) | Khaliq_aur_Makhlooq_..> | 2019-08-31 16:27 | 7.2M | |
![[SND]](/icons/sound2.gif) | Khatm_e-Bukhari Dara..> | 2019-08-31 16:27 | 8.7M | |
![[SND]](/icons/sound2.gif) | Khatm e Bukhari Jami..> | 2021-03-08 08:10 | 11M | |
![[SND]](/icons/sound2.gif) | Khatm e Bukhari Jami..> | 2021-03-14 16:40 | 13M | |
![[SND]](/icons/sound2.gif) | Khatm e Bukhari Jami..> | 2021-03-09 03:39 | 10M | |
![[SND]](/icons/sound2.gif) | Khatm e Bukhari Prog..> | 2025-02-05 05:15 | 9.9M | |
![[SND]](/icons/sound2.gif) | Khatm e Quran__Quran..> | 2022-05-07 05:18 | 7.0M | |
![[SND]](/icons/sound2.gif) | Khatm e bukhari Muft..> | 2022-02-21 13:22 | 12M | |
![[SND]](/icons/sound2.gif) | Khidmat Key Aadab_Mu..> | 2019-08-31 16:27 | 6.6M | |
![[SND]](/icons/sound2.gif) | Khuda ki Neyamateyn ..> | 2019-08-31 16:27 | 12M | |
![[SND]](/icons/sound2.gif) | Khushow khuzow Namaz..> | 2019-08-31 16:27 | 9.6M | |
![[SND]](/icons/sound2.gif) | Khutbah Eidul Fite 1..> | 2019-08-31 16:27 | 5.8M | |
![[SND]](/icons/sound2.gif) | Kitab Shariat O Tari..> | 2023-11-02 05:28 | 15M | |
![[SND]](/icons/sound2.gif) | Kitab Shariat O Tari..> | 2023-11-02 05:29 | 11M | |
![[SND]](/icons/sound2.gif) | Kitab Shariat O Tari..> | 2023-11-08 03:55 | 15M | |
![[SND]](/icons/sound2.gif) | Kitab Shariat O Tari..> | 2023-11-13 15:48 | 12M | |
![[SND]](/icons/sound2.gif) | Kitab Shariat O Tari..> | 2023-11-20 06:04 | 11M | |
![[SND]](/icons/sound2.gif) | Kitab Shariat O Tari..> | 2024-01-10 07:49 | 14M | |
![[SND]](/icons/sound2.gif) | Kitab Shariat O Tari..> | 2024-01-10 05:45 | 13M | |
![[SND]](/icons/sound2.gif) | Kitab Shariat O Tari..> | 2024-01-23 03:38 | 11M | |
![[SND]](/icons/sound2.gif) | Kitab Shariat O Tari..> | 2024-01-29 09:29 | 14M | |
![[SND]](/icons/sound2.gif) | MUFTI_TAQI_USMANI_SA..> | 2019-08-31 16:27 | 3.1M | |
![[SND]](/icons/sound2.gif) | M_M_TAQI_TUMHARE_NIG..> | 2019-08-31 16:27 | 8.7M | |
![[SND]](/icons/sound2.gif) | Maahe Ramazan-Ghafla..> | 2019-08-31 16:27 | 6.8M | |
![[SND]](/icons/sound2.gif) | Maahe Ramazan Aur Sa..> | 2019-08-31 16:27 | 4.5M | |
![[SND]](/icons/sound2.gif) | Maahe Zulqaada Ki Hu..> | 2019-08-31 16:27 | 2.8M | |
![[SND]](/icons/sound2.gif) | Maal_k_liae_ kalmah_..> | 2019-08-31 16:27 | 5.0M | |
![[SND]](/icons/sound2.gif) | MaasiyatSayBeBarkati..> | 2019-08-31 16:27 | 2.6M | |
![[SND]](/icons/sound2.gif) | Madrasa Registration..> | 2024-12-21 04:11 | 15M | |
![[SND]](/icons/sound2.gif) | Majlis_ki_Barkat Suf..> | 2019-08-31 16:27 | 8.4M | |
![[SND]](/icons/sound2.gif) | Makaram e Akhlaq Muf..> | 2019-08-31 16:27 | 7.9M | |
![[SND]](/icons/sound2.gif) | Makhlukh_sai_Muhabba..> | 2019-08-31 16:27 | 7.2M | |
![[SND]](/icons/sound2.gif) | Malfozat e Hakeem Ul..> | 2023-05-15 07:54 | 14M | |
![[SND]](/icons/sound2.gif) | Malfozat e Hakeem Ul..> | 2023-10-16 06:37 | 11M | |
![[SND]](/icons/sound2.gif) | Malfozat e Hakeem Ul..> | 2023-05-23 15:43 | 11M | |
![[SND]](/icons/sound2.gif) | Malfozat e Hakeem Ul..> | 2023-08-08 05:15 | 12M | |
![[SND]](/icons/sound2.gif) | Malfozat e Hakeem Ul..> | 2023-08-22 03:57 | 12M | |
![[SND]](/icons/sound2.gif) | Maojoda Jangi Halat ..> | 2025-05-10 03:53 | 5.6M | |
![[SND]](/icons/sound2.gif) | Maqam e Aadab aur Ad..> | 2019-08-31 16:27 | 7.9M | |
![[SND]](/icons/sound2.gif) | Maqam e Abdeyyat aur..> | 2019-08-31 16:27 | 12M | |
![[SND]](/icons/sound2.gif) | Masaala e sood Mufti..> | 2019-08-31 16:27 | 1.2M | |
![[SND]](/icons/sound2.gif) | Masla Falastin _ Mus..> | 2024-01-08 03:57 | 11M | |
![[SND]](/icons/sound2.gif) | Masla Falastin _ Tam..> | 2025-04-12 04:51 | 8.2M | |
![[SND]](/icons/sound2.gif) | Mazaq O Tamaskhar Se..> | 2023-04-20 05:48 | 14M | |
![[SND]](/icons/sound2.gif) | Mazloom Musalmano ke..> | 2025-04-15 07:29 | 6.4M | |
![[SND]](/icons/sound2.gif) | Mehman wa Mezbaan ke..> | 2019-08-31 16:27 | 7.8M | |
![[SND]](/icons/sound2.gif) | Mowasat Ki Dil Pasze..> | 2019-08-31 16:27 | 7.8M | |
![[SND]](/icons/sound2.gif) | Mowasat Ki Tafseer O..> | 2019-08-31 16:27 | 8.6M | |
![[SND]](/icons/sound2.gif) | Muaarfat E Ilahi_Muf..> | 2019-08-31 16:27 | 6.0M | |
![[SND]](/icons/sound2.gif) | Muasherat_ke_Buniyad..> | 2019-08-31 16:27 | 10M | |
![[SND]](/icons/sound2.gif) | Mufti Mohammad Taqi ..> | 2019-08-31 16:27 | 10M | |
![[SND]](/icons/sound2.gif) | MuftiTaqiUsmaniInter..> | 2019-08-31 16:27 | 6.2M | |
![[SND]](/icons/sound2.gif) | Mufti_M_Taqi_usmani_..> | 2019-08-31 16:27 | 8.9M | |
![[SND]](/icons/sound2.gif) | Mufti_Mohammad_Taqi_..> | 2019-08-31 16:27 | 10M | |
![[SND]](/icons/sound2.gif) | Muharram Ul Haram Ki..> | 2019-08-31 16:27 | 2.5M | |
![[SND]](/icons/sound2.gif) | Muharram aur Youm-e-..> | 2025-07-05 04:43 | 7.2M | |
![[SND]](/icons/sound2.gif) | Mujahida e Nafs Maar..> | 2019-08-31 16:27 | 14M | |
![[SND]](/icons/sound2.gif) | Mulaqat ke Aadab wa ..> | 2019-08-31 16:27 | 9.2M | |
![[SND]](/icons/sound2.gif) | Munajaat e Maqbool_A..> | 2022-02-01 07:07 | 13M | |
![[SND]](/icons/sound2.gif) | Munajaat e Maqbool_A..> | 2022-12-26 09:24 | 12M | |
![[SND]](/icons/sound2.gif) | Munajaat e Maqbool_A..> | 2023-01-04 04:34 | 12M | |
![[SND]](/icons/sound2.gif) | Munajaat e Maqbool_D..> | 2023-01-23 13:12 | 15M | |
![[SND]](/icons/sound2.gif) | Munajaat e Maqbool_D..> | 2023-01-31 09:37 | 14M | |
![[SND]](/icons/sound2.gif) | Munajat e Maqbool_Du..> | 2019-08-31 16:27 | 12M | |
![[SND]](/icons/sound2.gif) | Munajat e Maqbool_Du..> | 2019-08-31 16:28 | 12M | |
![[SND]](/icons/sound2.gif) | Munajat e Maqbool_Du..> | 2019-08-31 16:28 | 7.4M | |
![[SND]](/icons/sound2.gif) | Munajat e Maqbool_Du..> | 2019-08-31 16:28 | 8.7M | |
![[SND]](/icons/sound2.gif) | Munajat e Maqbool_Du..> | 2019-08-31 16:28 | 5.2M | |
![[SND]](/icons/sound2.gif) | Munajat e Maqbool_Du..> | 2019-08-31 16:28 | 8.5M | |
![[SND]](/icons/sound2.gif) | Munajat e Maqbool_Du..> | 2019-08-31 16:28 | 8.9M | |
![[SND]](/icons/sound2.gif) | Munajat e Maqbool_Du..> | 2019-08-31 16:28 | 8.5M | |
![[SND]](/icons/sound2.gif) | Munajat e Maqbool_Du..> | 2019-08-31 16:27 | 11M | |
![[SND]](/icons/sound2.gif) | Munajat e Maqbool_Du..> | 2019-08-31 16:27 | 12M | |
![[SND]](/icons/sound2.gif) | Munajat e Maqbool_Du..> | 2019-08-31 16:27 | 14M | |
![[SND]](/icons/sound2.gif) | Munajat e Maqbool_Du..> | 2019-09-22 14:51 | 11M | |
![[SND]](/icons/sound2.gif) | Munajat e Maqbool_Du..> | 2019-10-27 13:59 | 12M | |
![[SND]](/icons/sound2.gif) | Munajat e Maqbool_Du..> | 2019-11-17 14:32 | 12M | |
![[SND]](/icons/sound2.gif) | Munajat e Maqbool_Du..> | 2019-11-24 13:58 | 9.6M | |
![[SND]](/icons/sound2.gif) | Munajat e Maqbool_Du..> | 2019-12-16 08:50 | 12M | |
![[SND]](/icons/sound2.gif) | Munajat e Maqbool_Du..> | 2019-12-23 03:18 | 9.7M | |
![[SND]](/icons/sound2.gif) | Munajat e Maqbool_Du..> | 2020-01-20 03:05 | 9.6M | |
![[SND]](/icons/sound2.gif) | Munajat e Maqbool_Du..> | 2020-01-26 14:29 | 11M | |
![[SND]](/icons/sound2.gif) | Munajat e Maqbool_Du..> | 2020-02-23 14:39 | 13M | |
![[SND]](/icons/sound2.gif) | Munajat e Maqbool_Du..> | 2020-03-01 14:49 | 8.0M | |
![[SND]](/icons/sound2.gif) | Munajat e Maqbool_Du..> | 2020-03-09 02:47 | 9.1M | |
![[SND]](/icons/sound2.gif) | Munajat e Maqbool_Du..> | 2019-08-31 16:27 | 10M | |
![[SND]](/icons/sound2.gif) | Muqabelah_Nafs_aur_S..> | 2019-08-31 16:28 | 6.6M | |
![[SND]](/icons/sound2.gif) | Muqabelah_Nafs_ka Mu..> | 2019-08-31 16:28 | 7.2M | |
![[SND]](/icons/sound2.gif) | Muraqaba-e-Maut ki Z..> | 2024-12-16 06:01 | 21M | |
![[SND]](/icons/sound2.gif) | Musalman Bhai Ko By ..> | 2024-01-17 04:46 | 11M | |
![[SND]](/icons/sound2.gif) | Naap Tol Main Kami K..> | 2019-08-31 16:28 | 3.0M | |
![[SND]](/icons/sound2.gif) | Nafs_ka_mahasebah au..> | 2019-08-31 16:28 | 9.0M | |
![[SND]](/icons/sound2.gif) | Nafs_ka_mahasebah au..> | 2019-08-31 16:28 | 9.0M | |
![[SND]](/icons/sound2.gif) | Nafs ki Rukawt 04_07..> | 2019-08-31 16:28 | 8.4M | |
![[SND]](/icons/sound2.gif) | Naiki Aur Taqwa Mein..> | 2019-08-31 16:28 | 11M | |
![[SND]](/icons/sound2.gif) | Namaz Main Khashoo Q..> | 2019-08-31 16:28 | 11M | |
![[SND]](/icons/sound2.gif) | Nek Aamal Qurb e Ela..> | 2019-08-31 16:28 | 11M | |
![[SND]](/icons/sound2.gif) | Nek Amal waseelah au..> | 2019-08-31 16:28 | 12M | |
![[SND]](/icons/sound2.gif) | Nekion ka Ehtemaam k..> | 2019-08-31 16:28 | 11M | |
![[SND]](/icons/sound2.gif) | Neyamatun ko Ghalat ..> | 2019-08-31 16:28 | 9.8M | |
![[SND]](/icons/sound2.gif) | Nikah_Zindagi_ka_ek_..> | 2019-08-31 16:28 | 14M | |
![[SND]](/icons/sound2.gif) | Noor e Imaan ko kaam..> | 2019-08-31 16:28 | 5.3M | |
![[SND]](/icons/sound2.gif) | Pakistan Azeem Naima..> | 2022-08-25 04:52 | 11M | |
![[SND]](/icons/sound2.gif) | Paletine Ky Nashyb O..> | 2023-12-10 09:12 | 14M | |
![[SND]](/icons/sound2.gif) | Peghaam e Rabiyul Aw..> | 2019-08-31 16:28 | 3.9M | |
![[SND]](/icons/sound2.gif) | Phalestan Ky Maujoda..> | 2023-11-13 03:35 | 11M | |
![[SND]](/icons/sound2.gif) | Phalestan Ky Maujoda..> | 2023-10-14 03:37 | 14M | |
![[SND]](/icons/sound2.gif) | Qanaat aur Barakat k..> | 2022-09-06 03:26 | 12M | |
![[SND]](/icons/sound2.gif) | Qanaat wa Tawakkal M..> | 2019-08-31 16:28 | 6.8M | |
![[SND]](/icons/sound2.gif) | Qarz muasherati zaro..> | 2019-08-31 16:28 | 10M | |
![[SND]](/icons/sound2.gif) | Qatel Hamlahwar aur ..> | 2019-08-31 16:28 | 14M | |
![[SND]](/icons/sound2.gif) | Qomi Falastin Confer..> | 2024-10-08 04:13 | 4.2M | |
![[SND]](/icons/sound2.gif) | Qurbani hukum baja ..> | 2019-08-31 16:28 | 5.7M | |
![[SND]](/icons/sound2.gif) | Rabiul Awwal Ka Asal..> | 2023-09-23 06:14 | 13M | |
![[SND]](/icons/sound2.gif) | Raftar wa Ghuftar Ma..> | 2019-08-31 16:28 | 6.3M | |
![[SND]](/icons/sound2.gif) | Rahman ke Banday Par..> | 2021-04-14 09:03 | 11M | |
![[SND]](/icons/sound2.gif) | Rahmat e Aalam s ki ..> | 2019-08-31 16:28 | 9.3M | |
![[SND]](/icons/sound2.gif) | Rahmat e Aalam s ki ..> | 2019-08-31 16:28 | 7.7M | |
![[SND]](/icons/sound2.gif) | Ramadaan Husul e Taq..> | 2023-03-28 04:09 | 12M | |
![[SND]](/icons/sound2.gif) | Ramadaan hum par saa..> | 2019-08-31 16:28 | 11M | |
![[SND]](/icons/sound2.gif) | Ramadaan ki Aakheri ..> | 2022-05-01 04:53 | 9.4M | |
![[SND]](/icons/sound2.gif) | Ramadan Kay Baad Bhi..> | 2019-08-31 16:28 | 3.5M | |
![[SND]](/icons/sound2.gif) | Ramadan Ko Salaamti ..> | 2019-08-31 16:28 | 5.4M | |
![[SND]](/icons/sound2.gif) | Ramadan Nafs ki Tarb..> | 2019-08-31 16:28 | 8.5M | |
![[SND]](/icons/sound2.gif) | Ramadan Taqwa ki Tar..> | 2025-03-10 04:55 | 7.3M | |
![[SND]](/icons/sound2.gif) | Ramadan_ka_maqsad_ta..> | 2019-08-31 16:28 | 953K | |
![[SND]](/icons/sound2.gif) | Ramadan_ki_tayyeri_k..> | 2019-08-31 16:28 | 14M | |
![[SND]](/icons/sound2.gif) | Ramadan e Mubarak Du..> | 2019-08-31 16:28 | 12M | |
![[SND]](/icons/sound2.gif) | Ramadan husul e Taqw..> | 2019-08-31 16:28 | 8.3M | |
![[SND]](/icons/sound2.gif) | Ramazaan ka Khutbah ..> | 2019-08-31 16:28 | 14M | |
![[SND]](/icons/sound2.gif) | Ramazan Kay Baad Zin..> | 2019-08-31 16:28 | 4.7M | |
![[SND]](/icons/sound2.gif) | Ramazan Ki Ebadat Ki..> | 2023-04-19 04:38 | 12M | |
![[SND]](/icons/sound2.gif) | Ramazan Taqwa Aur Ha..> | 2019-08-31 16:28 | 3.8M | |
![[SND]](/icons/sound2.gif) | Ramazan me Sabar ki ..> | 2019-08-31 16:28 | 11M | |
![[SND]](/icons/sound2.gif) | Ramzan Husool-E-Taqw..> | 2019-08-31 16:28 | 13M | |
![[SND]](/icons/sound2.gif) | Ramzan Key Faiuz O B..> | 2019-08-31 16:28 | 7.8M | |
![[SND]](/icons/sound2.gif) | Ramzan Main Dua Ko W..> | 2019-08-31 16:28 | 10M | |
![[SND]](/icons/sound2.gif) | Ramzan Sabar O Musaw..> | 2019-08-31 16:28 | 7.2M | |
![[ ]](/icons/unknown.gif) | Riba (sood).asf | 2019-08-31 16:28 | 1.2M | |
![[SND]](/icons/sound2.gif) | Rozay-ki_Hikmat-aur_..> | 2019-08-31 16:28 | 7.3M | |
![[SND]](/icons/sound2.gif) | Ruzay_ki_Farzeyyat_a..> | 2019-08-31 16:28 | 4.7M | |
![[SND]](/icons/sound2.gif) | Ruzay_se_Nafs_ki_Tar..> | 2019-08-31 16:28 | 7.7M | |
![[SND]](/icons/sound2.gif) | Ruzay ka Badlah aur ..> | 2022-04-11 06:33 | 4.4M | |
![[SND]](/icons/sound2.gif) | Saaf Dil Narmi aur S..> | 2019-08-31 16:28 | 11M | |
![[SND]](/icons/sound2.gif) | Safar Nama _Maalta a..> | 2019-08-31 16:28 | 14M | |
![[SND]](/icons/sound2.gif) | Saheehul Bukhari, Ki..> | 2019-08-31 16:28 | 15M | |
![[SND]](/icons/sound2.gif) | Saheehul Bukhari_ Ki..> | 2019-08-31 16:28 | 9.2M | |
![[SND]](/icons/sound2.gif) | Saheehul Bukhari_ Ki..> | 2019-08-31 16:28 | 7.1M | |
![[SND]](/icons/sound2.gif) | Saheehul Bukhari_ Ki..> | 2019-08-31 16:28 | 14M | |
![[SND]](/icons/sound2.gif) | Saheehul Bukhari_ Ki..> | 2019-08-31 16:28 | 15M | |
![[SND]](/icons/sound2.gif) | Saheehul Bukhari_ Ki..> | 2019-08-31 16:28 | 15M | |
![[SND]](/icons/sound2.gif) | Saheehul Bukhari_ Ki..> | 2019-08-31 16:28 | 15M | |
![[SND]](/icons/sound2.gif) | Saheehul Bukhari_ Ki..> | 2019-08-31 16:28 | 15M | |
![[SND]](/icons/sound2.gif) | Saheehul_ Bukhari,Ki..> | 2019-08-31 16:28 | 14M | |
![[SND]](/icons/sound2.gif) | Sakhawat Mufti_Moham..> | 2019-08-31 16:28 | 7.8M | |
![[SND]](/icons/sound2.gif) | Sakhawat khasayel e ..> | 2019-08-31 16:28 | 8.0M | |
![[SND]](/icons/sound2.gif) | Sanad_E_Hifazat_Deen..> | 2019-08-31 16:28 | 7.7M | |
![[SND]](/icons/sound2.gif) | Sarkar e Do Alam ky ..> | 2023-09-30 02:12 | 12M | |
![[SND]](/icons/sound2.gif) | Sehatmadi Daulatmand..> | 2019-08-31 16:28 | 10M | |
![[SND]](/icons/sound2.gif) | Shaan e Nuzool Surah..> | 2019-08-31 16:28 | 3.1M | |
![[SND]](/icons/sound2.gif) | Shabe Baraat Kay Faz..> | 2019-08-31 16:28 | 6.3M | |
![[SND]](/icons/sound2.gif) | Shekh_ko_bimari_bata..> | 2019-08-31 16:28 | 1.7M | |
![[SND]](/icons/sound2.gif) | Shukar Aur Duaa Qurb..> | 2019-08-31 16:28 | 7.8M | |
![[SND]](/icons/sound2.gif) | Shukr ki kasarat me ..> | 2019-08-31 16:28 | 8.8M | |
![[SND]](/icons/sound2.gif) | Sifat e Raham se Aar..> | 2023-01-15 04:52 | 13M | |
![[SND]](/icons/sound2.gif) | Tafaqquh_FidDeen_And..> | 2019-08-31 16:28 | 8.7M | |
![[SND]](/icons/sound2.gif) | Tafseer-Surah-Shams-..> | 2019-08-31 16:28 | 6.1M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Aadiya..> | 2019-08-31 16:28 | 6.2M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Aadiya..> | 2019-08-31 16:28 | 4.7M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Aadiy..> | 2019-08-31 16:28 | 3.9M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Aadiya..> | 2019-08-31 16:28 | 6.4M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Aadiya..> | 2019-08-31 16:28 | 4.1M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Asr - ..> | 2019-08-31 16:28 | 4.8M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Asr - ..> | 2019-08-31 16:28 | 4.7M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Asr - ..> | 2019-08-31 16:28 | 4.0M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Asr - ..> | 2019-08-31 16:28 | 5.6M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Asr - ..> | 2019-08-31 16:28 | 5.4M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Asr - ..> | 2019-08-31 16:28 | 5.7M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Asr - ..> | 2019-08-31 16:28 | 5.1M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Asr - ..> | 2019-08-31 16:28 | 4.4M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Falaq ..> | 2019-08-31 16:28 | 3.0M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Falaq ..> | 2019-08-31 16:28 | 3.3M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Falaq ..> | 2019-08-31 16:28 | 2.7M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Feel -..> | 2019-08-31 16:28 | 4.3M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Feel-I..> | 2019-08-31 16:28 | 4.7M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Humaza..> | 2019-08-31 16:28 | 5.7M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Humaza..> | 2019-08-31 16:28 | 5.0M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Ikhlaa..> | 2019-08-31 16:28 | 5.2M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Kaafir..> | 2019-08-31 16:28 | 3.6M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Kaafir..> | 2019-08-31 16:28 | 6.0M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Kausar..> | 2019-08-31 16:28 | 5.2M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Lahab ..> | 2019-08-31 16:28 | 5.0M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Lahab ..> | 2019-08-31 16:28 | 5.0M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Maaoon..> | 2019-08-31 16:28 | 5.0M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Maaoon..> | 2019-08-31 16:28 | 4.5M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Maaoon..> | 2019-08-31 16:28 | 4.6M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Maoon.mp3 | 2019-08-31 16:28 | 5.0M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Naas -..> | 2019-08-31 16:28 | 3.7M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Naas-2..> | 2019-08-31 16:28 | 3.7M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Naas-3..> | 2019-08-31 16:28 | 5.1M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Naas -..> | 2019-08-31 16:28 | 4.4M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Nasr-I..> | 2019-08-31 16:28 | 4.6M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Nasr-I..> | 2019-08-31 16:28 | 4.1M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Nasr-I..> | 2019-08-31 16:28 | 4.7M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Qurais..> | 2019-08-31 16:28 | 5.6M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Takasu..> | 2019-08-31 16:28 | 5.4M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Takasu..> | 2019-08-31 16:28 | 3.8M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Takasu..> | 2019-08-31 16:28 | 4.1M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Takasu..> | 2019-08-31 16:28 | 4.3M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Takasu..> | 2019-08-31 16:28 | 3.5M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Takasu..> | 2019-08-31 16:28 | 4.1M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Takasu..> | 2019-08-31 16:28 | 5.0M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Takasu..> | 2019-08-31 16:28 | 4.6M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Zilzaa..> | 2019-08-31 16:28 | 6.1M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Zilzaa..> | 2019-08-31 16:28 | 7.1M | |
![[SND]](/icons/sound2.gif) | Tafseer Surah Zilzaa..> | 2019-08-31 16:28 | 6.1M | |
![[SND]](/icons/sound2.gif) | Tahafuzz-e-Namoos-e-..> | 2019-08-31 16:28 | 7.9M | |
![[SND]](/icons/sound2.gif) | Takhleeq e Insaan ka..> | 2022-03-28 04:27 | 5.5M | |
![[SND]](/icons/sound2.gif) | Takmeel Dars-e-Bukha..> | 2023-02-15 13:30 | 17M | |
![[SND]](/icons/sound2.gif) | Takmeel Quran Kareem..> | 2025-03-26 06:36 | 7.5M | |
![[SND]](/icons/sound2.gif) | Takmeel e Ramazan Pr..> | 2019-08-31 16:28 | 9.7M | |
![[SND]](/icons/sound2.gif) | Takmeel e ramadan pa..> | 2019-08-31 16:28 | 8.6M | |
![[SND]](/icons/sound2.gif) | Talab e Saadeq Mufti..> | 2021-01-11 14:11 | 9.1M | |
![[SND]](/icons/sound2.gif) | Talab e sadeq Manzil..> | 2019-08-31 16:28 | 11M | |
![[SND]](/icons/sound2.gif) | Talebaan ki Jeet Aur..> | 2021-09-08 03:08 | 7.4M | |
![[SND]](/icons/sound2.gif) | Taqrer, Khutbah, Nam..> | 2019-08-31 16:28 | 10M | |
![[SND]](/icons/sound2.gif) | Taqwa Or Maah-E-Rama..> | 2019-08-31 16:28 | 13M | |
![[SND]](/icons/sound2.gif) | Taqwah sadd e jaraye..> | 2019-08-31 16:28 | 10M | |
![[SND]](/icons/sound2.gif) | Taqwah zareyatul Usu..> | 2019-08-31 16:28 | 7.2M | |
![[SND]](/icons/sound2.gif) | Targheeb E Mujahida_..> | 2019-08-31 16:28 | 6.4M | |
![[SND]](/icons/sound2.gif) | Tasawwf aur Ehsaan k..> | 2019-08-31 16:28 | 10M | |
![[SND]](/icons/sound2.gif) | Tasheeh Neyyat Taree..> | 2019-08-31 16:28 | 7.8M | |
![[SND]](/icons/sound2.gif) | Tawajjah E Akhrat Ki..> | 2019-08-31 16:28 | 6.2M | |
![[SND]](/icons/sound2.gif) | Tawazuo aur Enkesaar..> | 2019-08-31 16:28 | 8.9M | |
![[SND]](/icons/sound2.gif) | Tawazuow_khidmat_ki_..> | 2019-08-31 16:28 | 7.3M | |
![[SND]](/icons/sound2.gif) | Tum Hi Sar Baland Ho..> | 2023-08-17 04:04 | 15M | |
![[SND]](/icons/sound2.gif) | Ujoob Aur Hubb E Jaa..> | 2019-08-31 16:28 | 6.5M | |
![[SND]](/icons/sound2.gif) | Ulama Program Jamiah..> | 2025-02-05 04:58 | 15M | |
![[SND]](/icons/sound2.gif) | Uulul Albaab aur unk..> | 2025-06-22 04:35 | 6.2M | |
![[SND]](/icons/sound2.gif) | Vol_Jum_17_Ramzan_Ma..> | 2019-08-31 16:28 | 2.7M | |
![[SND]](/icons/sound2.gif) | Wiladat Ba'Sadat (12..> | 2019-08-31 16:28 | 8.1M | |
![[SND]](/icons/sound2.gif) | Wiladat Ba'Sadat Ki ..> | 2019-08-31 16:28 | 8.1M | |
![[SND]](/icons/sound2.gif) | Yaqeen_Maafi_aur_Aaf..> | 2019-08-31 16:28 | 9.3M | |
![[SND]](/icons/sound2.gif) | Yom e Arafa Ki Fazee..> | 2019-08-31 16:28 | 5.4M | |
![[SND]](/icons/sound2.gif) | Yom e Ashura Ki Faze..> | 2019-08-31 16:28 | 6.9M | |
![[SND]](/icons/sound2.gif) | ZAAYERIN_E_HERMAAIN_..> | 2019-08-31 16:28 | 7.9M | |
![[SND]](/icons/sound2.gif) | ZAKAT_KI_FARZIAT_FAZ..> | 2019-08-31 16:28 | 14M | |
![[SND]](/icons/sound2.gif) | ZIKR_MUASSAR_HATAYAR..> | 2019-08-31 16:28 | 9.5M | |
![[SND]](/icons/sound2.gif) | Zaban Se Tanazani Ba..> | 2023-04-20 07:28 | 13M | |
![[SND]](/icons/sound2.gif) | Zaban_ki_Aafateyn M..> | 2019-08-31 16:28 | 12M | |
![[SND]](/icons/sound2.gif) | Zaban be laagaam ki ..> | 2019-12-21 09:01 | 6.3M | |
![[SND]](/icons/sound2.gif) | Zaban ki Hifazat par..> | 2019-12-28 08:57 | 6.9M | |
![[SND]](/icons/sound2.gif) | Zaban ki Naimat ka s..> | 2025-01-04 04:45 | 5.6M | |
![[SND]](/icons/sound2.gif) | Zakaat Ki Aham Taree..> | 2019-08-31 16:28 | 3.8M | |
![[SND]](/icons/sound2.gif) | Zikar O Tasbeehat Qu..> | 2019-08-31 16:28 | 6.6M | |
![[SND]](/icons/sound2.gif) | Zikr-ul-Allah se Gha..> | 2025-06-11 06:01 | 6.8M | |
![[SND]](/icons/sound2.gif) | Zikr_ki_madawmat_sai..> | 2019-08-31 16:28 | 8.6M | |
![[SND]](/icons/sound2.gif) | Zikr wa Duaa Nuskha ..> | 2019-08-31 16:28 | 12M | |
![[SND]](/icons/sound2.gif) | Zikr wa Fikr Allah T..> | 2022-04-30 05:26 | 6.1M | |
![[SND]](/icons/sound2.gif) | Zuban Ki Larzish Aur..> | 2019-08-31 16:28 | 9.2M | |
![[SND]](/icons/sound2.gif) | Zulm Ka Gunah Or Maz..> | 2024-01-22 03:42 | 15M | |
![[SND]](/icons/sound2.gif) | allamahMuftiMuhammad..> | 2019-08-31 16:28 | 7.6M | |
![[SND]](/icons/sound2.gif) | bayan1.rm | 2019-08-31 16:28 | 6.7M | |
![[SND]](/icons/sound2.gif) | hiqd_aur_kina_160120..> | 2019-08-31 16:28 | 1.7M | |
![[SND]](/icons/sound2.gif) | ikhtilaf-ke-hudud Ba..> | 2019-08-31 16:28 | 14M | |
![[SND]](/icons/sound2.gif) | khat_wa_kitabat_ke_A..> | 2019-08-31 16:28 | 9.7M | |
![[SND]](/icons/sound2.gif) | kom bulna kom suuna ..> | 2019-08-31 16:28 | 11M | |
![[SND]](/icons/sound2.gif) | kon_sa_amal_afzal_ha..> | 2019-08-31 16:28 | 3.1M | |
![[SND]](/icons/sound2.gif) | uzan e Aamal aur Ima..> | 2020-03-16 03:16 | 9.4M | |
![[SND]](/icons/sound2.gif) | vol_149 Shaaban safe..> | 2019-08-31 16:28 | 2.1M | |
![[SND]](/icons/sound2.gif) | vol_200 Raahat_wa_Mu..> | 2019-08-31 16:28 | 2.7M | |
![[SND]](/icons/sound2.gif) | vol_202 Suhbat_e_hum..> | 2019-08-31 16:28 | 1.4M | |
![[SND]](/icons/sound2.gif) | vol_Jum_18_Ramzan_Ma..> | 2019-08-31 16:28 | 3.2M | |
![[SND]](/icons/sound2.gif) | vol_Jum_19_Maqsade_A..> | 2019-08-31 16:28 | 3.3M | |
![[SND]](/icons/sound2.gif) | vol_jum_1_RazaBilQaz..> | 2019-08-31 16:28 | 4.4M | |
![[SND]](/icons/sound2.gif) | vol_jum_2_TafseerSur..> | 2019-08-31 16:28 | 3.4M | |
![[SND]](/icons/sound2.gif) | vol_jum_3_TafseerSur..> | 2019-08-31 16:28 | 3.5M | |
![[SND]](/icons/sound2.gif) | vol_jum_4_TafseerSur..> | 2019-08-31 16:28 | 2.5M | |
![[SND]](/icons/sound2.gif) | vol_jum_5_TafseerSur..> | 2019-08-31 16:28 | 3.0M | |
![[SND]](/icons/sound2.gif) | vol_jum_6_TafseerSur..> | 2019-08-31 16:28 | 5.1M | |
![[SND]](/icons/sound2.gif) | vol_jum_7_TafseerSur..> | 2019-08-31 16:28 | 2.9M | |
![[SND]](/icons/sound2.gif) | vol_jum_8_TafseerSur..> | 2019-08-31 16:28 | 2.6M | |
![[SND]](/icons/sound2.gif) | vol_jum_9_TafseerSur..> | 2019-08-31 16:28 | 1.9M | |
![[SND]](/icons/sound2.gif) | vol_jum_10_TafseerSu..> | 2019-08-31 16:28 | 3.4M | |
![[SND]](/icons/sound2.gif) | vol_jum_11_TafseerSu..> | 2019-08-31 16:28 | 3.3M | |
![[SND]](/icons/sound2.gif) | vol_jum_12_TafseerSu..> | 2019-08-31 16:28 | 3.0M | |
![[SND]](/icons/sound2.gif) | vol_jum_13_TafseerSu..> | 2019-08-31 16:28 | 3.5M | |
![[SND]](/icons/sound2.gif) | vol_jum_14_Maqasid_e..> | 2019-08-31 16:28 | 4.1M | |
![[SND]](/icons/sound2.gif) | vol_jum_15_Mulk_Kay_..> | 2019-08-31 16:28 | 2.5M | |
![[SND]](/icons/sound2.gif) | vol_jum_16_Shabe_Bar..> | 2019-08-31 16:28 | 3.3M | |
![[SND]](/icons/sound2.gif) | www_deeneislam_com_i..> | 2019-08-31 16:28 | 731K | |
|